C24H25F7N2O6S2 — CID 58601437
[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]-2-[(2-methyl-1-methylsulfinylpropan-2-yl)carbamoyl]phenyl] methanesulfonate (PubChem CID 58601437) has the molecular formula C24H25F7N2O6S2 and a molecular weight of 634.59 g/mol. Its IUPAC name is [3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]-2-[(2-methyl-1-methylsulfinylpropan-2-yl)carbamoyl]phenyl] methanesulfonate.
| Compound Name | [3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]-2-[(2-methyl-1-methylsulfinylpropan-2-yl)carbamoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 58601437 |
| Molecular Formula | C24H25F7N2O6S2 |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | [3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]-2-[(2-methyl-1-methylsulfinylpropan-2-yl)carbamoyl]phenyl] methanesulfonate |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(OS(C)(=O)=O)c1C(=O)NC(C)(C)CS(C)=O |
| InChI | InChI=1S/C24H25F7N2O6S2/c1-13-11-14(22(25,23(26,27)28)24(29,30)31)9-10-16(13)32-19(34)15-7-6-8-17(39-41(5,37)38)18(15)20(35)33-21(2,3)12-40(4)36/h6-11H,12H2,1-5H3,(H,32,34)(H,33,35) |
| InChIKey | JJCHFJYKMSPOQK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|