C25H18F7IN2O2S — CID 139940791
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methylsulfanylphenyl)benzene-1,2-dicarboxamide (PubChem CID 139940791) has the molecular formula C25H18F7IN2O2S and a molecular weight of 670.39 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methylsulfanylphenyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methylsulfanylphenyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139940791 |
| Molecular Formula | C25H18F7IN2O2S |
| Molecular Weight | 670.39 g/mol |
| Exact Mass | 670.00 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methylsulfanylphenyl)benzene-1,2-dicarboxamide |
| SMILES | CSc1ccccc1NC(=O)c1c(I)cccc1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C25H18F7IN2O2S/c1-13-12-14(23(26,24(27,28)29)25(30,31)32)10-11-17(13)34-21(36)15-6-5-7-16(33)20(15)22(37)35-18-8-3-4-9-19(18)38-2/h3-12H,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | VFWSERRWKWXPMX-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.39 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|