C27H21F7IN3O3 — CID 140681298
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methoxyimino-2-phenylethyl)benzene-1,2-dicarboxamide (PubChem CID 140681298) has the molecular formula C27H21F7IN3O3 and a molecular weight of 695.37 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methoxyimino-2-phenylethyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methoxyimino-2-phenylethyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 140681298 |
| Molecular Formula | C27H21F7IN3O3 |
| Molecular Weight | 695.37 g/mol |
| Exact Mass | 695.05 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methoxyimino-2-phenylethyl)benzene-1,2-dicarboxamide |
| SMILES | CON=C(CNC(=O)c1c(I)cccc1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C)c1ccccc1 |
| InChI | InChI=1S/C27H21F7IN3O3/c1-15-13-17(25(28,26(29,30)31)27(32,33)34)11-12-20(15)37-23(39)18-9-6-10-19(35)22(18)24(40)36-14-21(38-41-2)16-7-4-3-5-8-16/h3-13H,14H2,1-2H3,(H,36,40)(H,37,39) |
| InChIKey | RBAYFEMXSPQUIK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.37 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|