C24H16F7IN2O2 — CID 87631106
N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]phenyl]-2-iodobenzamide (PubChem CID 87631106) has the molecular formula C24H16F7IN2O2 and a molecular weight of 624.29 g/mol. Its IUPAC name is N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]phenyl]-2-iodobenzamide.
| Compound Name | N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 87631106 |
| Molecular Formula | C24H16F7IN2O2 |
| Molecular Weight | 624.29 g/mol |
| Exact Mass | 624.01 |
| IUPAC Name | N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]carbamoyl]phenyl]-2-iodobenzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(NC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C24H16F7IN2O2/c1-13-11-15(22(25,23(26,27)28)24(29,30)31)9-10-19(13)34-20(35)14-5-4-6-16(12-14)33-21(36)17-7-2-3-8-18(17)32/h2-12H,1H3,(H,33,36)(H,34,35) |
| InChIKey | IICJOZLGIFDSJH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.29 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|