C29H25F7N2O4 — CID 123916812
2-[3-[[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamoyl]-2-methylphenyl]propanoic acid (PubChem CID 123916812) has the molecular formula C29H25F7N2O4 and a molecular weight of 598.52 g/mol. Its IUPAC name is 2-[3-[[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamoyl]-2-methylphenyl]propanoic acid.
| Compound Name | 2-[3-[[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamoyl]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 123916812 |
| Molecular Formula | C29H25F7N2O4 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-[3-[[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamoyl]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2cccc(C(C)C(=O)O)c2C)c1 |
| InChI | InChI=1S/C29H25F7N2O4/c1-14-11-19(27(30,28(31,32)33)29(34,35)36)12-15(2)23(14)38-24(39)18-7-5-8-20(13-18)37-25(40)22-10-6-9-21(16(22)3)17(4)26(41)42/h5-13,17H,1-4H3,(H,37,40)(H,38,39)(H,41,42) |
| InChIKey | COWXCCPNGWUQOC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |