C24H17F8N3O2 — CID 58399658
2-fluoro-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 58399658) has the molecular formula C24H17F8N3O2 and a molecular weight of 531.40 g/mol. Its IUPAC name is 2-fluoro-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58399658 |
| Molecular Formula | C24H17F8N3O2 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-fluoro-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2cccnc2F)c1 |
| InChI | InChI=1S/C24H17F8N3O2/c1-12-9-15(22(26,23(27,28)29)24(30,31)32)10-13(2)18(12)35-20(36)14-5-3-6-16(11-14)34-21(37)17-7-4-8-33-19(17)25/h3-11H,1-2H3,(H,34,37)(H,35,36) |
| InChIKey | AMJSPFRUEQPNSR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|