C30H25ClF3N3O5S — CID 87295034
[1-[4-[[3-[(2-chloropyridine-3-carbonyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-2,2,2-trifluoro-1-phenylethyl] methanesulfonate (PubChem CID 87295034) has the molecular formula C30H25ClF3N3O5S and a molecular weight of 632.06 g/mol. Its IUPAC name is [1-[4-[[3-[(2-chloropyridine-3-carbonyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-2,2,2-trifluoro-1-phenylethyl] methanesulfonate.
| Compound Name | [1-[4-[[3-[(2-chloropyridine-3-carbonyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-2,2,2-trifluoro-1-phenylethyl] methanesulfonate |
|---|---|
| PubChem CID | 87295034 |
| Molecular Formula | C30H25ClF3N3O5S |
| Molecular Weight | 632.06 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | [1-[4-[[3-[(2-chloropyridine-3-carbonyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-2,2,2-trifluoro-1-phenylethyl] methanesulfonate |
| SMILES | Cc1cc(C(OS(C)(=O)=O)(c2ccccc2)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2cccnc2Cl)c1 |
| InChI | InChI=1S/C30H25ClF3N3O5S/c1-18-15-22(29(30(32,33)34,42-43(3,40)41)21-10-5-4-6-11-21)16-19(2)25(18)37-27(38)20-9-7-12-23(17-20)36-28(39)24-13-8-14-35-26(24)31/h4-17H,1-3H3,(H,36,39)(H,37,38) |
| InChIKey | ZWZGSZFFYBXDRM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.06 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|