C29H21ClF9N5O2 — CID 86656554
2-chloro-N-[3-[[2-ethyl-4-[1,1,1,3,3,3-hexafluoro-2-[4-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]-6-methylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 86656554) has the molecular formula C29H21ClF9N5O2 and a molecular weight of 677.96 g/mol. Its IUPAC name is 2-chloro-N-[3-[[2-ethyl-4-[1,1,1,3,3,3-hexafluoro-2-[4-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]-6-methylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[[2-ethyl-4-[1,1,1,3,3,3-hexafluoro-2-[4-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]-6-methylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86656554 |
| Molecular Formula | C29H21ClF9N5O2 |
| Molecular Weight | 677.96 g/mol |
| Exact Mass | 677.12 |
| IUPAC Name | 2-chloro-N-[3-[[2-ethyl-4-[1,1,1,3,3,3-hexafluoro-2-[4-(trifluoromethyl)pyrazol-1-yl]propan-2-yl]-6-methylphenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(C(n2cc(C(F)(F)F)cn2)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2cccnc2Cl)c1 |
| InChI | InChI=1S/C29H21ClF9N5O2/c1-3-16-11-18(26(28(34,35)36,29(37,38)39)44-14-19(13-41-44)27(31,32)33)10-15(2)22(16)43-24(45)17-6-4-7-20(12-17)42-25(46)21-8-5-9-40-23(21)30/h4-14H,3H2,1-2H3,(H,42,46)(H,43,45) |
| InChIKey | JFSIJIAWOPSVCH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.96 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|