C23H11Br2ClF9N3O2 — CID 87289175
2-chloro-N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 87289175) has the molecular formula C23H11Br2ClF9N3O2 and a molecular weight of 727.60 g/mol. Its IUPAC name is 2-chloro-N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87289175 |
| Molecular Formula | C23H11Br2ClF9N3O2 |
| Molecular Weight | 727.60 g/mol |
| Exact Mass | 724.88 |
| IUPAC Name | 2-chloro-N-[3-[[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1Br)c1cccc(NC(=O)c2cccnc2Cl)c1 |
| InChI | InChI=1S/C23H11Br2ClF9N3O2/c24-14-8-11(20(27,22(30,31)32)21(28,29)23(33,34)35)9-15(25)16(14)38-18(39)10-3-1-4-12(7-10)37-19(40)13-5-2-6-36-17(13)26/h1-9H,(H,37,40)(H,38,39) |
| InChIKey | BEWZDHKRAWFHOF-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.60 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|