C23H13Br2F7N2O2S — CID 87336381
3-benzamido-N-[2,6-dibromo-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide (PubChem CID 87336381) has the molecular formula C23H13Br2F7N2O2S and a molecular weight of 674.23 g/mol. Its IUPAC name is 3-benzamido-N-[2,6-dibromo-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide.
| Compound Name | 3-benzamido-N-[2,6-dibromo-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87336381 |
| Molecular Formula | C23H13Br2F7N2O2S |
| Molecular Weight | 674.23 g/mol |
| Exact Mass | 671.90 |
| IUPAC Name | 3-benzamido-N-[2,6-dibromo-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2c(Br)cc(SC(F)(F)C(F)(F)C(F)(F)F)cc2Br)c1)c1ccccc1 |
| InChI | InChI=1S/C23H13Br2F7N2O2S/c24-16-10-15(37-23(31,32)21(26,27)22(28,29)30)11-17(25)18(16)34-20(36)13-7-4-8-14(9-13)33-19(35)12-5-2-1-3-6-12/h1-11H,(H,33,35)(H,34,36) |
| InChIKey | CWJGYPQIPKSOEC-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.23 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|