C25H15Br2F9N2O2 — CID 87289011
3-[benzoyl(methyl)amino]-N-[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide (PubChem CID 87289011) has the molecular formula C25H15Br2F9N2O2 and a molecular weight of 706.20 g/mol. Its IUPAC name is 3-[benzoyl(methyl)amino]-N-[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide.
| Compound Name | 3-[benzoyl(methyl)amino]-N-[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 87289011 |
| Molecular Formula | C25H15Br2F9N2O2 |
| Molecular Weight | 706.20 g/mol |
| Exact Mass | 703.94 |
| IUPAC Name | 3-[benzoyl(methyl)amino]-N-[2,6-dibromo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
| SMILES | CN(C(=O)c1ccccc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2Br)c1 |
| InChI | InChI=1S/C25H15Br2F9N2O2/c1-38(21(40)13-6-3-2-4-7-13)16-9-5-8-14(10-16)20(39)37-19-17(26)11-15(12-18(19)27)22(28,24(31,32)33)23(29,30)25(34,35)36/h2-12H,1H3,(H,37,39) |
| InChIKey | YSHRZWHDNIQQTM-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.20 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|