C24H16F6I2N2O3 — CID 86656563
3-benzamido-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide (PubChem CID 86656563) has the molecular formula C24H16F6I2N2O3 and a molecular weight of 748.20 g/mol. Its IUPAC name is 3-benzamido-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide.
| Compound Name | 3-benzamido-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide |
|---|---|
| PubChem CID | 86656563 |
| Molecular Formula | C24H16F6I2N2O3 |
| Molecular Weight | 748.20 g/mol |
| Exact Mass | 747.92 |
| IUPAC Name | 3-benzamido-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide |
| SMILES | COC(c1cc(I)c(NC(=O)c2cccc(NC(=O)c3ccccc3)c2)c(I)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H16F6I2N2O3/c1-37-22(23(25,26)27,24(28,29)30)15-11-17(31)19(18(32)12-15)34-21(36)14-8-5-9-16(10-14)33-20(35)13-6-3-2-4-7-13/h2-12H,1H3,(H,33,35)(H,34,36) |
| InChIKey | SBPJZXIIBXINOD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.20 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|