C17H12F6I2N2O2 — CID 86656562
3-amino-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide (PubChem CID 86656562) has the molecular formula C17H12F6I2N2O2 and a molecular weight of 644.09 g/mol. Its IUPAC name is 3-amino-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide.
| Compound Name | 3-amino-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide |
|---|---|
| PubChem CID | 86656562 |
| Molecular Formula | C17H12F6I2N2O2 |
| Molecular Weight | 644.09 g/mol |
| Exact Mass | 643.89 |
| IUPAC Name | 3-amino-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-2,6-diiodophenyl]benzamide |
| SMILES | COC(c1cc(I)c(NC(=O)c2cccc(N)c2)c(I)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H12F6I2N2O2/c1-29-15(16(18,19)20,17(21,22)23)9-6-11(24)13(12(25)7-9)27-14(28)8-3-2-4-10(26)5-8/h2-7H,26H2,1H3,(H,27,28) |
| InChIKey | WMJZNCMFOIKQOT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.09 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|