C26H20F8N2O5S — CID 87361800
[2-[4-[[3-[(2,6-difluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] methanesulfonate (PubChem CID 87361800) has the molecular formula C26H20F8N2O5S and a molecular weight of 624.51 g/mol. Its IUPAC name is [2-[4-[[3-[(2,6-difluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] methanesulfonate.
| Compound Name | [2-[4-[[3-[(2,6-difluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 87361800 |
| Molecular Formula | C26H20F8N2O5S |
| Molecular Weight | 624.51 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | [2-[4-[[3-[(2,6-difluorobenzoyl)amino]benzoyl]amino]-3,5-dimethylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] methanesulfonate |
| SMILES | Cc1cc(C(OS(C)(=O)=O)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C26H20F8N2O5S/c1-13-10-16(24(25(29,30)31,26(32,33)34)41-42(3,39)40)11-14(2)21(13)36-22(37)15-6-4-7-17(12-15)35-23(38)20-18(27)8-5-9-19(20)28/h4-12H,1-3H3,(H,35,38)(H,36,37) |
| InChIKey | RAXJDKMWAURLAZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|