C21H17Cl3F6N2O4 — CID 23123829
2,2,2-trichloroethyl N-[3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate (PubChem CID 23123829) has the molecular formula C21H17Cl3F6N2O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 23123829 |
| Molecular Formula | C21H17Cl3F6N2O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 580.02 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)OCC(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C21H17Cl3F6N2O4/c1-10-6-13(19(35,20(25,26)27)21(28,29)30)7-11(2)15(10)32-16(33)12-4-3-5-14(8-12)31-17(34)36-9-18(22,23)24/h3-8,35H,9H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | ZLKUJNNTXUPFRC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|