C22H15Cl3F7N3O3 — CID 88864530
2,2,2-trichloroethyl N-[3-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate (PubChem CID 88864530) has the molecular formula C22H15Cl3F7N3O3 and a molecular weight of 608.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 88864530 |
| Molecular Formula | C22H15Cl3F7N3O3 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-cyano-5-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]carbamoyl]phenyl]carbamate |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cc(C#N)cc(NC(=O)OCC(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C22H15Cl3F7N3O3/c1-10-3-14(20(26,21(27,28)29)22(30,31)32)4-11(2)16(10)35-17(36)13-5-12(8-33)6-15(7-13)34-18(37)38-9-19(23,24)25/h3-7H,9H2,1-2H3,(H,34,37)(H,35,36) |
| InChIKey | WBYDNEOEOYRKAR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|