C16H15Cl3N2O2 — CID 146612128
2,2,2-trichloroethyl N-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamate (PubChem CID 146612128) has the molecular formula C16H15Cl3N2O2 and a molecular weight of 373.67 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamate |
|---|---|
| PubChem CID | 146612128 |
| Molecular Formula | C16H15Cl3N2O2 |
| Molecular Weight | 373.67 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,2,2-trichloroethyl N-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamate |
| SMILES | N#Cc1c2c(c(NC(=O)OCC(Cl)(Cl)Cl)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C16H15Cl3N2O2/c17-16(18,19)8-23-15(22)21-14-11-5-1-3-9(11)13(7-20)10-4-2-6-12(10)14/h1-6,8H2,(H,21,22) |
| InChIKey | COUWPZGFQYNRFC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|