C20H22N4O4S2 — CID 164927406
1-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]sulfonyl]urea (PubChem CID 164927406) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]sulfonyl]urea.
| Compound Name | 1-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]sulfonyl]urea |
|---|---|
| PubChem CID | 164927406 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]sulfonyl]urea |
| SMILES | CC(C)(O)c1ncsc1S(=O)(=O)NC(=O)Nc1c2c(c(C#N)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C20H22N4O4S2/c1-20(2,26)17-18(29-10-22-17)30(27,28)24-19(25)23-16-13-7-3-5-11(13)15(9-21)12-6-4-8-14(12)16/h10,26H,3-8H2,1-2H3,(H2,23,24,25) |
| InChIKey | CZOPGSUFMVLOJO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |