C10H6ClF3N2O2 — CID 43168455
2,2,2-trifluoroethyl N-(3-chloro-4-cyanophenyl)carbamate (PubChem CID 43168455) has the molecular formula C10H6ClF3N2O2 and a molecular weight of 278.62 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(3-chloro-4-cyanophenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(3-chloro-4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 43168455 |
| Molecular Formula | C10H6ClF3N2O2 |
| Molecular Weight | 278.62 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(3-chloro-4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)OCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H6ClF3N2O2/c11-8-3-7(2-1-6(8)4-15)16-9(17)18-5-10(12,13)14/h1-3H,5H2,(H,16,17) |
| InChIKey | QLWPVESAWPCBGM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |