C13H10ClF3N2O4 — CID 4765001
methyl 4-(3-chloro-4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 4765001) has the molecular formula C13H10ClF3N2O4 and a molecular weight of 350.68 g/mol. Its IUPAC name is methyl 4-(3-chloro-4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | methyl 4-(3-chloro-4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 4765001 |
| Molecular Formula | C13H10ClF3N2O4 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | methyl 4-(3-chloro-4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | COC(=O)C(O)(CC(=O)Nc1ccc(C#N)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N2O4/c1-23-11(21)12(22,13(15,16)17)5-10(20)19-8-3-2-7(6-18)9(14)4-8/h2-4,22H,5H2,1H3,(H,19,20) |
| InChIKey | XLKPIHLQBRJVRB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |