C14H13F3N2O4 — CID 7028451
ethyl (2S)-4-(4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 7028451) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is ethyl (2S)-4-(4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | ethyl (2S)-4-(4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 7028451 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | ethyl (2S)-4-(4-cyanoanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)[C@@](O)(CC(=O)Nc1ccc(C#N)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O4/c1-2-23-12(21)13(22,14(15,16)17)7-11(20)19-10-5-3-9(8-18)4-6-10/h3-6,22H,2,7H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | RVYJYFATDOZCAL-ZDUSSCGKSA-N |
| XLogP | 1.74 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |