C14H17N3O4 — CID 97307855
ethyl (2S)-3-[(4-cyanophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoate (PubChem CID 97307855) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl (2S)-3-[(4-cyanophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoate.
| Compound Name | ethyl (2S)-3-[(4-cyanophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 97307855 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl (2S)-3-[(4-cyanophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)[C@@](C)(O)CNC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-3-21-12(18)14(2,20)9-16-13(19)17-11-6-4-10(8-15)5-7-11/h4-7,20H,3,9H2,1-2H3,(H2,16,17,19)/t14-/m0/s1 |
| InChIKey | YBVBZSPUDNTMQR-AWEZNQCLSA-N |
| XLogP | 0.99 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |