C14H19N3O2 — CID 103710020
1-(4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea (PubChem CID 103710020) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
|---|---|
| PubChem CID | 103710020 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
| SMILES | CC(C)(CCO)CNC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,7-8-18)10-16-13(19)17-12-5-3-11(9-15)4-6-12/h3-6,18H,7-8,10H2,1-2H3,(H2,16,17,19) |
| InChIKey | DHZCFSIDQCVPGB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |