C13H13F3N2O6 — CID 19578777
ethyl 2-hydroxy-4-(4-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 19578777) has the molecular formula C13H13F3N2O6 and a molecular weight of 350.25 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-(4-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | ethyl 2-hydroxy-4-(4-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 19578777 |
| Molecular Formula | C13H13F3N2O6 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | ethyl 2-hydroxy-4-(4-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)C(O)(CC(=O)Nc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O6/c1-2-24-11(20)12(21,13(14,15)16)7-10(19)17-8-3-5-9(6-4-8)18(22)23/h3-6,21H,2,7H2,1H3,(H,17,19) |
| InChIKey | DPFBHYGWXUEDPC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|