C18H19ClN2O5 — CID 44551267
ethyl (2R,3S)-3-(4-chloroanilino)-2-hydroxy-2-methyl-3-(4-nitrophenyl)propanoate (PubChem CID 44551267) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(4-chloroanilino)-2-hydroxy-2-methyl-3-(4-nitrophenyl)propanoate.
| Compound Name | ethyl (2R,3S)-3-(4-chloroanilino)-2-hydroxy-2-methyl-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 44551267 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | ethyl (2R,3S)-3-(4-chloroanilino)-2-hydroxy-2-methyl-3-(4-nitrophenyl)propanoate |
| SMILES | CCOC(=O)[C@](C)(O)[C@@H](Nc1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-3-26-17(22)18(2,23)16(20-14-8-6-13(19)7-9-14)12-4-10-15(11-5-12)21(24)25/h4-11,16,20,23H,3H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | OMDBZMHVVCLNSV-FUHWJXTLSA-N |
| XLogP | 3.72 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|