C15H18F3NO5 — CID 19578934
ethyl 2-hydroxy-4-(2-methoxy-5-methylanilino)-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 19578934) has the molecular formula C15H18F3NO5 and a molecular weight of 349.31 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-(2-methoxy-5-methylanilino)-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | ethyl 2-hydroxy-4-(2-methoxy-5-methylanilino)-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 19578934 |
| Molecular Formula | C15H18F3NO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 2-hydroxy-4-(2-methoxy-5-methylanilino)-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)C(O)(CC(=O)Nc1cc(C)ccc1OC)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO5/c1-4-24-13(21)14(22,15(16,17)18)8-12(20)19-10-7-9(2)5-6-11(10)23-3/h5-7,22H,4,8H2,1-3H3,(H,19,20) |
| InChIKey | INRORJVMDFZONK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |