C13H13Cl3N2O3 — CID 146618234
2,2,2-trichloroethyl N-(2-formyl-3-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)carbamate (PubChem CID 146618234) has the molecular formula C13H13Cl3N2O3 and a molecular weight of 351.62 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(2-formyl-3-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(2-formyl-3-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)carbamate |
|---|---|
| PubChem CID | 146618234 |
| Molecular Formula | C13H13Cl3N2O3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-(2-formyl-3-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)carbamate |
| SMILES | Cc1c(C=O)nc2c(c1NC(=O)OCC(Cl)(Cl)Cl)CCC2 |
| InChI | InChI=1S/C13H13Cl3N2O3/c1-7-10(5-19)17-9-4-2-3-8(9)11(7)18-12(20)21-6-13(14,15)16/h5H,2-4,6H2,1H3,(H,17,18,20) |
| InChIKey | AIYIKHKIMJLOLS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|