C20H14F7N3O4 — CID 87494710
4-cyano-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(methoxymethyl)-6-methylphenyl]-3-nitrobenzamide (PubChem CID 87494710) has the molecular formula C20H14F7N3O4 and a molecular weight of 493.34 g/mol. Its IUPAC name is 4-cyano-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(methoxymethyl)-6-methylphenyl]-3-nitrobenzamide.
| Compound Name | 4-cyano-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(methoxymethyl)-6-methylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 87494710 |
| Molecular Formula | C20H14F7N3O4 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-cyano-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(methoxymethyl)-6-methylphenyl]-3-nitrobenzamide |
| SMILES | COCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14F7N3O4/c1-10-5-14(18(21,19(22,23)24)20(25,26)27)6-13(9-34-2)16(10)29-17(31)11-3-4-12(8-28)15(7-11)30(32)33/h3-7H,9H2,1-2H3,(H,29,31) |
| InChIKey | VJGWXNWMIFSPNN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|