C22H18F9N3O — CID 87495556
3-amino-4-cyano-N-[2,6-diethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide (PubChem CID 87495556) has the molecular formula C22H18F9N3O and a molecular weight of 511.39 g/mol. Its IUPAC name is 3-amino-4-cyano-N-[2,6-diethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide.
| Compound Name | 3-amino-4-cyano-N-[2,6-diethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 87495556 |
| Molecular Formula | C22H18F9N3O |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 3-amino-4-cyano-N-[2,6-diethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(CC)c1NC(=O)c1ccc(C#N)c(N)c1 |
| InChI | InChI=1S/C22H18F9N3O/c1-3-11-7-15(19(23,21(26,27)28)20(24,25)22(29,30)31)8-12(4-2)17(11)34-18(35)13-5-6-14(10-32)16(33)9-13/h5-9H,3-4,33H2,1-2H3,(H,34,35) |
| InChIKey | KTLBGRMLLGCRKR-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|