C30H27F9N2O4S — CID 44598519
4-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-methyl-1-N-[(4-methylsulfonylphenyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 44598519) has the molecular formula C30H27F9N2O4S and a molecular weight of 682.61 g/mol. Its IUPAC name is 4-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-methyl-1-N-[(4-methylsulfonylphenyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-methyl-1-N-[(4-methylsulfonylphenyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 44598519 |
| Molecular Formula | C30H27F9N2O4S |
| Molecular Weight | 682.61 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | 4-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-methyl-1-N-[(4-methylsulfonylphenyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(C(=O)NCc2ccc(S(C)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C30H27F9N2O4S/c1-5-19-14-21(27(31,29(34,35)36)28(32,33)30(37,38)39)13-17(3)24(19)41-25(42)20-8-11-23(16(2)12-20)26(43)40-15-18-6-9-22(10-7-18)46(4,44)45/h6-14H,5,15H2,1-4H3,(H,40,43)(H,41,42) |
| InChIKey | ARPKBVYMTBIJKI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|