C23H21F7N2O3 — CID 88531191
[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid (PubChem CID 88531191) has the molecular formula C23H21F7N2O3 and a molecular weight of 506.42 g/mol. Its IUPAC name is [5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid.
| Compound Name | [5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
|---|---|
| PubChem CID | 88531191 |
| Molecular Formula | C23H21F7N2O3 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc2c(c1)CCC2NC(=O)O |
| InChI | InChI=1S/C23H21F7N2O3/c1-3-12-10-15(21(24,22(25,26)27)23(28,29)30)8-11(2)18(12)32-19(33)14-4-6-16-13(9-14)5-7-17(16)31-20(34)35/h4,6,8-10,17,31H,3,5,7H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | MCBNOZXDGQGXSS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |