C26H25F7N2O2 — CID 50938847
1-(cyclopropanecarbonylamino)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 50938847) has the molecular formula C26H25F7N2O2 and a molecular weight of 530.48 g/mol. Its IUPAC name is 1-(cyclopropanecarbonylamino)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | 1-(cyclopropanecarbonylamino)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 50938847 |
| Molecular Formula | C26H25F7N2O2 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 1-(cyclopropanecarbonylamino)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc2c(c1)CCC2NC(=O)C1CC1 |
| InChI | InChI=1S/C26H25F7N2O2/c1-3-14-12-18(24(27,25(28,29)30)26(31,32)33)10-13(2)21(14)35-23(37)17-6-8-19-16(11-17)7-9-20(19)34-22(36)15-4-5-15/h6,8,10-12,15,20H,3-5,7,9H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | CQVQHCJEKBXJGG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |