C26H30F5NO — CID 129016497
1-ethyl-N-[2-ethyl-6-methyl-4-(2,2,3,4,4-pentafluoropentan-3-yl)phenyl]-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 129016497) has the molecular formula C26H30F5NO and a molecular weight of 467.52 g/mol. Its IUPAC name is 1-ethyl-N-[2-ethyl-6-methyl-4-(2,2,3,4,4-pentafluoropentan-3-yl)phenyl]-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | 1-ethyl-N-[2-ethyl-6-methyl-4-(2,2,3,4,4-pentafluoropentan-3-yl)phenyl]-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 129016497 |
| Molecular Formula | C26H30F5NO |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-ethyl-N-[2-ethyl-6-methyl-4-(2,2,3,4,4-pentafluoropentan-3-yl)phenyl]-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CCc1cc(C(F)(C(C)(F)F)C(C)(F)F)cc(C)c1NC(=O)c1ccc2c(c1)CCC2CC |
| InChI | InChI=1S/C26H30F5NO/c1-6-16-8-9-18-13-19(10-11-21(16)18)23(33)32-22-15(3)12-20(14-17(22)7-2)26(31,24(4,27)28)25(5,29)30/h10-14,16H,6-9H2,1-5H3,(H,32,33) |
| InChIKey | XJLXZRDTBZHKCD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |