C22H24F6N3O2+ — CID 123288950
[1-[4-[[4-(acetamidomethyl)benzoyl]amino]-3-ethyl-5-methylphenyl]-1,2,2-trifluoropropyl]-trifluoroazanium (PubChem CID 123288950) has the molecular formula C22H24F6N3O2+ and a molecular weight of 476.44 g/mol. Its IUPAC name is [1-[4-[[4-(acetamidomethyl)benzoyl]amino]-3-ethyl-5-methylphenyl]-1,2,2-trifluoropropyl]-trifluoroazanium.
| Compound Name | [1-[4-[[4-(acetamidomethyl)benzoyl]amino]-3-ethyl-5-methylphenyl]-1,2,2-trifluoropropyl]-trifluoroazanium |
|---|---|
| PubChem CID | 123288950 |
| Molecular Formula | C22H24F6N3O2+ |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [1-[4-[[4-(acetamidomethyl)benzoyl]amino]-3-ethyl-5-methylphenyl]-1,2,2-trifluoropropyl]-trifluoroazanium |
| SMILES | CCc1cc(C(F)(C(C)(F)F)[N+](F)(F)F)cc(C)c1NC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C22H23F6N3O2/c1-5-16-11-18(22(25,21(4,23)24)31(26,27)28)10-13(2)19(16)30-20(33)17-8-6-15(7-9-17)12-29-14(3)32/h6-11H,5,12H2,1-4H3,(H-,29,30,32,33)/p+1 |
| InChIKey | XUTRIIWYZHRVDM-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|