C25H26F9N3O2 — CID 50938739
6-[(2,2-dimethylpropanoylamino)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 50938739) has the molecular formula C25H26F9N3O2 and a molecular weight of 571.48 g/mol. Its IUPAC name is 6-[(2,2-dimethylpropanoylamino)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-[(2,2-dimethylpropanoylamino)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50938739 |
| Molecular Formula | C25H26F9N3O2 |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 6-[(2,2-dimethylpropanoylamino)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(CNC(=O)C(C)(C)C)nc1 |
| InChI | InChI=1S/C25H26F9N3O2/c1-6-14-10-16(22(26,24(29,30)31)23(27,28)25(32,33)34)9-13(2)18(14)37-19(38)15-7-8-17(35-11-15)12-36-20(39)21(3,4)5/h7-11H,6,12H2,1-5H3,(H,36,39)(H,37,38) |
| InChIKey | XDCRRAACJBADIT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|