C27H28F7N5O3 — CID 88539122
tert-butyl N-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamate (PubChem CID 88539122) has the molecular formula C27H28F7N5O3 and a molecular weight of 603.54 g/mol. Its IUPAC name is tert-butyl N-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 88539122 |
| Molecular Formula | C27H28F7N5O3 |
| Molecular Weight | 603.54 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | tert-butyl N-[[5-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]-2-(1,2,4-triazol-1-yl)phenyl]methyl]carbamate |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(-n2cncn2)c(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H28F7N5O3/c1-6-16-11-19(25(28,26(29,30)31)27(32,33)34)9-15(2)21(16)38-22(40)17-7-8-20(39-14-35-13-37-39)18(10-17)12-36-23(41)42-24(3,4)5/h7-11,13-14H,6,12H2,1-5H3,(H,36,41)(H,38,40) |
| InChIKey | WSOBTFYCPLFJFW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |