C20H26N6O5 — CID 71910980
tert-butyl N-[[5-methyl-1-[3-nitro-4-(1,2,4-triazol-1-yl)benzoyl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 71910980) has the molecular formula C20H26N6O5 and a molecular weight of 430.47 g/mol. Its IUPAC name is tert-butyl N-[[5-methyl-1-[3-nitro-4-(1,2,4-triazol-1-yl)benzoyl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-methyl-1-[3-nitro-4-(1,2,4-triazol-1-yl)benzoyl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71910980 |
| Molecular Formula | C20H26N6O5 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | tert-butyl N-[[5-methyl-1-[3-nitro-4-(1,2,4-triazol-1-yl)benzoyl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC1CC(CNC(=O)OC(C)(C)C)CN1C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N6O5/c1-13-7-14(9-22-19(28)31-20(2,3)4)10-24(13)18(27)15-5-6-16(17(8-15)26(29)30)25-12-21-11-23-25/h5-6,8,11-14H,7,9-10H2,1-4H3,(H,22,28) |
| InChIKey | ANGUKCMMFWUTRM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|