C22H20F7N5O — CID 87221503
3-(aminomethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 87221503) has the molecular formula C22H20F7N5O and a molecular weight of 503.42 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | 3-(aminomethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 87221503 |
| Molecular Formula | C22H20F7N5O |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 3-(aminomethyl)-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(-n2cncn2)c(CN)c1 |
| InChI | InChI=1S/C22H20F7N5O/c1-3-13-8-16(20(23,21(24,25)26)22(27,28)29)6-12(2)18(13)33-19(35)14-4-5-17(15(7-14)9-30)34-11-31-10-32-34/h4-8,10-11H,3,9,30H2,1-2H3,(H,33,35) |
| InChIKey | FTWWGIRKGVWYFH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |