C22H19F7N4O — CID 87089137
2-[2,6-diethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 87089137) has the molecular formula C22H19F7N4O and a molecular weight of 488.41 g/mol. Its IUPAC name is 2-[2,6-diethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2-[2,6-diethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 87089137 |
| Molecular Formula | C22H19F7N4O |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[2,6-diethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(CC)c1-c1cc(-n2cncn2)ccc1C(N)=O |
| InChI | InChI=1S/C22H19F7N4O/c1-3-12-7-14(20(23,21(24,25)26)22(27,28)29)8-13(4-2)18(12)17-9-15(33-11-31-10-32-33)5-6-16(17)19(30)34/h5-11H,3-4H2,1-2H3,(H2,30,34) |
| InChIKey | CDJCHRRFGAERHD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |