C13H10F7N3 — CID 173038498
1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2,4-triazole (PubChem CID 173038498) has the molecular formula C13H10F7N3 and a molecular weight of 341.23 g/mol. Its IUPAC name is 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2,4-triazole.
| Compound Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 173038498 |
| Molecular Formula | C13H10F7N3 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2,4-triazole |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-n1cncn1 |
| InChI | InChI=1S/C13H10F7N3/c1-7-3-9(11(14,12(15,16)17)13(18,19)20)4-8(2)10(7)23-6-21-5-22-23/h3-6H,1-2H3 |
| InChIKey | ALJVARVDVGYMRV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |