C8H11N5 — CID 147889927
1-(2,4,5-trimethylpyrazol-3-yl)-1,2,4-triazole (PubChem CID 147889927) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-(2,4,5-trimethylpyrazol-3-yl)-1,2,4-triazole.
| Compound Name | 1-(2,4,5-trimethylpyrazol-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 147889927 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-(2,4,5-trimethylpyrazol-3-yl)-1,2,4-triazole |
| SMILES | Cc1nn(C)c(-n2cncn2)c1C |
| InChI | InChI=1S/C8H11N5/c1-6-7(2)11-12(3)8(6)13-5-9-4-10-13/h4-5H,1-3H3 |
| InChIKey | ICBPJTHQKFDFOI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |