C9H10BrClN4 — CID 107085845
4-(bromomethyl)-5-(4-chloropyrazol-1-yl)-1,3-dimethylpyrazole (PubChem CID 107085845) has the molecular formula C9H10BrClN4 and a molecular weight of 289.56 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(4-chloropyrazol-1-yl)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(4-chloropyrazol-1-yl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107085845 |
| Molecular Formula | C9H10BrClN4 |
| Molecular Weight | 289.56 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 4-(bromomethyl)-5-(4-chloropyrazol-1-yl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(-n2cc(Cl)cn2)c1CBr |
| InChI | InChI=1S/C9H10BrClN4/c1-6-8(3-10)9(14(2)13-6)15-5-7(11)4-12-15/h4-5H,3H2,1-2H3 |
| InChIKey | RTDZGRAZXQXMMI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|