C11H18BrN3 — CID 130691382
4-(bromomethyl)-5-(3,3-dimethylazetidin-1-yl)-1,3-dimethylpyrazole (PubChem CID 130691382) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(3,3-dimethylazetidin-1-yl)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(3,3-dimethylazetidin-1-yl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 130691382 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-(bromomethyl)-5-(3,3-dimethylazetidin-1-yl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(N2CC(C)(C)C2)c1CBr |
| InChI | InChI=1S/C11H18BrN3/c1-8-9(5-12)10(14(4)13-8)15-6-11(2,3)7-15/h5-7H2,1-4H3 |
| InChIKey | WXKJJQZPXSCGDR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|