C11H19ClN4 — CID 28964290
1-[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-4-methylpiperazine (PubChem CID 28964290) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-4-methylpiperazine.
| Compound Name | 1-[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 28964290 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-4-methylpiperazine |
| SMILES | Cc1nn(C)c(N2CCN(C)CC2)c1CCl |
| InChI | InChI=1S/C11H19ClN4/c1-9-10(8-12)11(15(3)13-9)16-6-4-14(2)5-7-16/h4-8H2,1-3H3 |
| InChIKey | KXNRQUGLCFADMH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|