C14H19BrN6 — CID 107079291
2-[4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]pyrimidine (PubChem CID 107079291) has the molecular formula C14H19BrN6 and a molecular weight of 351.25 g/mol. Its IUPAC name is 2-[4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 107079291 |
| Molecular Formula | C14H19BrN6 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[4-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1nn(C)c(N2CCN(c3ncccn3)CC2)c1CBr |
| InChI | InChI=1S/C14H19BrN6/c1-11-12(10-15)13(19(2)18-11)20-6-8-21(9-7-20)14-16-4-3-5-17-14/h3-5H,6-10H2,1-2H3 |
| InChIKey | FYYMRSUICZVMAT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|