C13H22BrN3 — CID 107084959
4-(bromomethyl)-5-(2-ethyl-5-methylpyrrolidin-1-yl)-1,3-dimethylpyrazole (PubChem CID 107084959) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(2-ethyl-5-methylpyrrolidin-1-yl)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(2-ethyl-5-methylpyrrolidin-1-yl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107084959 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-(bromomethyl)-5-(2-ethyl-5-methylpyrrolidin-1-yl)-1,3-dimethylpyrazole |
| SMILES | CCC1CCC(C)N1c1c(CBr)c(C)nn1C |
| InChI | InChI=1S/C13H22BrN3/c1-5-11-7-6-9(2)17(11)13-12(8-14)10(3)15-16(13)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | XPTLUHJZHIPPJS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|