C15H17BrN4 — CID 107085724
1-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-5,6-dimethylbenzimidazole (PubChem CID 107085724) has the molecular formula C15H17BrN4 and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-5,6-dimethylbenzimidazole.
| Compound Name | 1-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 107085724 |
| Molecular Formula | C15H17BrN4 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[4-(bromomethyl)-1,3-dimethylpyrazol-5-yl]-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2ncn(-c3c(CBr)c(C)nn3C)c2cc1C |
| InChI | InChI=1S/C15H17BrN4/c1-9-5-13-14(6-10(9)2)20(8-17-13)15-12(7-16)11(3)18-19(15)4/h5-6,8H,7H2,1-4H3 |
| InChIKey | JKWGYGKXFXXLIF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|