C8H10N6 — CID 80854317
N,5-dimethyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine (PubChem CID 80854317) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is N,5-dimethyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine.
| Compound Name | N,5-dimethyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80854317 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | N,5-dimethyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
| SMILES | CNc1ncnc(-n2cncn2)c1C |
| InChI | InChI=1S/C8H10N6/c1-6-7(9-2)11-4-12-8(6)14-5-10-3-13-14/h3-5H,1-2H3,(H,9,11,12) |
| InChIKey | XJVATRPMXLSQBN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |