C5H5N7O2 — CID 12570974
1-methyl-3-nitro-5-(1,2,4-triazol-1-yl)-1,2,4-triazole (PubChem CID 12570974) has the molecular formula C5H5N7O2 and a molecular weight of 195.14 g/mol. Its IUPAC name is 1-methyl-3-nitro-5-(1,2,4-triazol-1-yl)-1,2,4-triazole.
| Compound Name | 1-methyl-3-nitro-5-(1,2,4-triazol-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 12570974 |
| Molecular Formula | C5H5N7O2 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1-methyl-3-nitro-5-(1,2,4-triazol-1-yl)-1,2,4-triazole |
| SMILES | Cn1nc([N+](=O)[O-])nc1-n1cncn1 |
| InChI | InChI=1S/C5H5N7O2/c1-10-5(11-3-6-2-7-11)8-4(9-10)12(13)14/h2-3H,1H3 |
| InChIKey | PVZPMHMEGVKPPV-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|