C7H7N7O2 — CID 80902448
[5-nitro-6-(1,2,4-triazol-1-yl)-2-pyridinyl]hydrazine (PubChem CID 80902448) has the molecular formula C7H7N7O2 and a molecular weight of 221.18 g/mol. Its IUPAC name is [5-nitro-6-(1,2,4-triazol-1-yl)-2-pyridinyl]hydrazine.
| Compound Name | [5-nitro-6-(1,2,4-triazol-1-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80902448 |
| Molecular Formula | C7H7N7O2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | [5-nitro-6-(1,2,4-triazol-1-yl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc([N+](=O)[O-])c(-n2cncn2)n1 |
| InChI | InChI=1S/C7H7N7O2/c8-12-6-2-1-5(14(15)16)7(11-6)13-4-9-3-10-13/h1-4H,8H2,(H,11,12) |
| InChIKey | UKLPHUSWZHXSCD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|